Pre-lab Assignment 1. Look up the reaction of alkenes with molecular bromine (Br

Question

Pre-lab Assignment 1. Look up the reaction of alkenes with molecular bromine (Brs). Write am equation fer the an equation for the reaction of cis-3-hexene with molecular bromine. Monoglycerides and diglycerides are often listed as ingredients in snack foods are triacylglycerols, what is a monoglyceride? a diglyceride? 2. Look up the terms "amphipathic" and "amphiphilic." what is the meaning of these term? How do they apply to soap? 3 4. Why is the hydrolysis of a fat called saponifleation 5. Dissolving very pure soap in water makes an alkaline solution (plH-9-10), Assuming a soap to be pure sodium stearate (18:0), give an equation that explains this property

Explanation / Answer

Solvef first two problem post multiple question to get the remaining answers

1) The reaction will be of the form

CH3-CH2-CH=CH-CH2-CH3 + Br2 ---------- CH3-CH2-CH(Br)-CH(Br)-CH2-CH3

The product will be of the form

3-4 dibromo Hexane

Since the initial orientation was cis, hence it will be either (S,S)-3,4-dibromo Hexane or (R,R) -3,4-dibromo Hexane

2) Monoglycerides - Glycerol

Diglycerides - Diglycerol

Related Questions

Navigate

• Browse (All)
• Browse P
• Subjects

---

---

Integrity-first tutoring: explanations and feedback only — we do not complete graded work. Learn more.